About 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile
3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile (PubChem CID 67135586) has the molecular formula C18H12BrF2N3O
and a molecular weight of 404.21 g/mol. Its IUPAC name is 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile.
Molecular Properties
| Compound Name | 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile |
| PubChem CID | 67135586 |
| Molecular Formula | C18H12BrF2N3O |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile |
| SMILES | Cc1nn(C)c(Oc2ccc(C#N)cc2Br)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C18H12BrF2N3O/c1-10-17(13-5-4-12(20)8-15(13)21)18(24(2)23-10)25-16-6-3-11(9-22)7-14(16)19/h3-8H,1-2H3 |
| InChIKey | XIUXHKYVNPGCEP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile?
The IUPAC name of 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile (CID 67135586) is 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile.
What is the SMILES notation for 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile?
The canonical SMILES for 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile is Cc1nn(C)c(Oc2ccc(C#N)cc2Br)c1-c1ccc(F)cc1F.
What is the InChIKey of 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile?
The InChIKey is XIUXHKYVNPGCEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrF2N3O/c1-10-17(13-5-4-12(20)8-15(13)21)18(24(2)23-10)25-16-6-3-11(9-22)7-14(16)19/h3-8H,1-2H3.
What are the key properties of 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile?
3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile has a molecular weight of 404.21 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[4-(2,4-difluorophenyl)-1,3-dimethylpyrazol-5-yl]oxybenzonitrile is sourced from PubChem (CID 67135586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).