C17H12F5N3O — CID 67136016
4-[1,3-dimethyl-4-(2,4,6-trifluorophenyl)pyrazol-5-yl]oxy-3,5-difluoroaniline (PubChem CID 67136016) has the molecular formula C17H12F5N3O and a molecular weight of 369.29 g/mol. Its IUPAC name is 4-[1,3-dimethyl-4-(2,4,6-trifluorophenyl)pyrazol-5-yl]oxy-3,5-difluoroaniline.
| Compound Name | 4-[1,3-dimethyl-4-(2,4,6-trifluorophenyl)pyrazol-5-yl]oxy-3,5-difluoroaniline |
|---|---|
| PubChem CID | 67136016 |
| Molecular Formula | C17H12F5N3O |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-[1,3-dimethyl-4-(2,4,6-trifluorophenyl)pyrazol-5-yl]oxy-3,5-difluoroaniline |
| SMILES | Cc1nn(C)c(Oc2c(F)cc(N)cc2F)c1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C17H12F5N3O/c1-7-14(15-10(19)3-8(18)4-11(15)20)17(25(2)24-7)26-16-12(21)5-9(23)6-13(16)22/h3-6H,23H2,1-2H3 |
| InChIKey | CCIUWADBFOJMDR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|