C20H26N4O3 — CID 67136222
2-(1-isoquinolin-1-ylpiperidin-4-yl)ethyl-[2-(methylamino)-2-oxoethyl]carbamic acid (PubChem CID 67136222) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(1-isoquinolin-1-ylpiperidin-4-yl)ethyl-[2-(methylamino)-2-oxoethyl]carbamic acid.
| Compound Name | 2-(1-isoquinolin-1-ylpiperidin-4-yl)ethyl-[2-(methylamino)-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 67136222 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-(1-isoquinolin-1-ylpiperidin-4-yl)ethyl-[2-(methylamino)-2-oxoethyl]carbamic acid |
| SMILES | CNC(=O)CN(CCC1CCN(c2nccc3ccccc23)CC1)C(=O)O |
| InChI | InChI=1S/C20H26N4O3/c1-21-18(25)14-24(20(26)27)13-9-15-7-11-23(12-8-15)19-17-5-3-2-4-16(17)6-10-22-19/h2-6,10,15H,7-9,11-14H2,1H3,(H,21,25)(H,26,27) |
| InChIKey | GVXHCGHNKCSTRG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |