C25H28FN3O4 — CID 67136922
1-(7-tert-butyl-1,3-benzoxazol-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone (PubChem CID 67136922) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is 1-(7-tert-butyl-1,3-benzoxazol-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone.
| Compound Name | 1-(7-tert-butyl-1,3-benzoxazol-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 67136922 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 1-(7-tert-butyl-1,3-benzoxazol-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc(C(C)(C)C)c2ocnc2c1 |
| InChI | InChI=1S/C25H28FN3O4/c1-6-31-19-10-15-11-29(24(27)20(15)21(26)23(19)32-7-2)12-18(30)14-8-16(25(3,4)5)22-17(9-14)28-13-33-22/h8-10,13,27H,6-7,11-12H2,1-5H3/b27-24- |
| InChIKey | GRPFMUKVXBVFJE-PNHLSOANSA-N |
| XLogP | 5.09 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|