C20H36N2O7SSi — CID 67137212
[(3R,6S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazol-3-yl] methyl carbonate (PubChem CID 67137212) has the molecular formula C20H36N2O7SSi and a molecular weight of 476.67 g/mol. Its IUPAC name is [(3R,6S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazol-3-yl] methyl carbonate.
| Compound Name | [(3R,6S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazol-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 67137212 |
| Molecular Formula | C20H36N2O7SSi |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [(3R,6S,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazol-3-yl] methyl carbonate |
| SMILES | COC(=O)O[C@@H]1CS[C@H]2C[C@@](CO[Si](C)(C)C(C)(C)C)(NC(=O)OC(C)(C)C)C(=O)N21 |
| InChI | InChI=1S/C20H36N2O7SSi/c1-18(2,3)29-16(24)21-20(12-27-31(8,9)19(4,5)6)10-14-22(15(20)23)13(11-30-14)28-17(25)26-7/h13-14H,10-12H2,1-9H3,(H,21,24)/t13-,14+,20+/m1/s1 |
| InChIKey | SXHLXBNORKTMBY-CKNLXJGOSA-N |
| XLogP | 3.69 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|