C11H14N6O2 — CID 6713759
4-aminobenzoic acid;pyrimidine-4,5,6-triamine (PubChem CID 6713759) has the molecular formula C11H14N6O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-aminobenzoic acid;pyrimidine-4,5,6-triamine.
| Compound Name | 4-aminobenzoic acid;pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 6713759 |
| Molecular Formula | C11H14N6O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-aminobenzoic acid;pyrimidine-4,5,6-triamine |
| SMILES | Nc1ccc(C(=O)O)cc1.Nc1ncnc(N)c1N |
| InChI | InChI=1S/C7H7NO2.C4H7N5/c8-6-3-1-5(2-4-6)7(9)10;5-2-3(6)8-1-9-4(2)7/h1-4H,8H2,(H,9,10);1H,5H2,(H4,6,7,8,9) |
| InChIKey | XENCPWDSVCNJIQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 167.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|