C13H14BrNO6 — CID 6713785
(1R,2R,3R,4S,5R,6S)-5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 6713785) has the molecular formula C13H14BrNO6 and a molecular weight of 360.16 g/mol. Its IUPAC name is (1R,2R,3R,4S,5R,6S)-5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | (1R,2R,3R,4S,5R,6S)-5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 6713785 |
| Molecular Formula | C13H14BrNO6 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | (1R,2R,3R,4S,5R,6S)-5-bromo-6-(2,5-dioxopyrrolidin-1-yl)bicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2C[C@H]([C@@H](Br)[C@H]2N2C(=O)CCC2=O)[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H14BrNO6/c14-10-4-3-5(9(13(20)21)8(4)12(18)19)11(10)15-6(16)1-2-7(15)17/h4-5,8-11H,1-3H2,(H,18,19)(H,20,21)/t4-,5+,8-,9+,10+,11-/m0/s1 |
| InChIKey | DGUWCGCSFBDQTL-RQKUXFEBSA-N |
| XLogP | 0.32 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|