C23H28N2O5 — CID 6713822
2-[(4S,12S,13R,14S,19R,21S)-7,8-dimethoxy-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,7,9,17-tetraen-14-yl]acetic acid (PubChem CID 6713822) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[(4S,12S,13R,14S,19R,21S)-7,8-dimethoxy-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,7,9,17-tetraen-14-yl]acetic acid.
| Compound Name | 2-[(4S,12S,13R,14S,19R,21S)-7,8-dimethoxy-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,7,9,17-tetraen-14-yl]acetic acid |
|---|---|
| PubChem CID | 6713822 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[(4S,12S,13R,14S,19R,21S)-7,8-dimethoxy-15-oxa-1,11-diazahexacyclo[16.3.1.04,12.04,21.05,10.013,19]docosa-5,7,9,17-tetraen-14-yl]acetic acid |
| SMILES | COc1cc2c(cc1OC)[C@]13CCN4CC5=CCO[C@@H](CC(=O)O)[C@H]([C@H]5C[C@H]41)[C@@H]3N2 |
| InChI | InChI=1S/C23H28N2O5/c1-28-16-8-14-15(9-17(16)29-2)24-22-21-13-7-19-23(14,22)4-5-25(19)11-12(13)3-6-30-18(21)10-20(26)27/h3,8-9,13,18-19,21-22,24H,4-7,10-11H2,1-2H3,(H,26,27)/t13-,18-,19-,21-,22-,23+/m0/s1 |
| InChIKey | RJTMEFDVTNQHTN-IBTVXLQLSA-N |
| XLogP | 2.26 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|