C8H14O6S — CID 6713838
methyl (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxane-2-carboxylate (PubChem CID 6713838) has the molecular formula C8H14O6S and a molecular weight of 238.26 g/mol. Its IUPAC name is methyl (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 6713838 |
| Molecular Formula | C8H14O6S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | methyl (2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H](SC)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H14O6S/c1-13-7(12)6-4(10)3(9)5(11)8(14-6)15-2/h3-6,8-11H,1-2H3/t3-,4-,5+,6-,8-/m1/s1 |
| InChIKey | TWHSJNDJIXZYCP-QOHYDMMQSA-N |
| XLogP | -1.67 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |