C9H11N3O3S — CID 67138420
5-[(2-aminophenyl)methyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 67138420) has the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 5-[(2-aminophenyl)methyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(2-aminophenyl)methyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 67138420 |
| Molecular Formula | C9H11N3O3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 5-[(2-aminophenyl)methyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | Nc1ccccc1CN1CC(=O)NS1(=O)=O |
| InChI | InChI=1S/C9H11N3O3S/c10-8-4-2-1-3-7(8)5-12-6-9(13)11-16(12,14)15/h1-4H,5-6,10H2,(H,11,13) |
| InChIKey | OGFTZPRFQOWKIB-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|