C26H30FN3O4 — CID 67138836
1-(7-tert-butyl-2-methyl-1,3-benzoxazol-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone (PubChem CID 67138836) has the molecular formula C26H30FN3O4 and a molecular weight of 467.54 g/mol. Its IUPAC name is 1-(7-tert-butyl-2-methyl-1,3-benzoxazol-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone.
| Compound Name | 1-(7-tert-butyl-2-methyl-1,3-benzoxazol-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 67138836 |
| Molecular Formula | C26H30FN3O4 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 1-(7-tert-butyl-2-methyl-1,3-benzoxazol-5-yl)-2-(5,6-diethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)ethanone |
| SMILES | [H]/N=C1/c2c(cc(OCC)c(OCC)c2F)CN1CC(=O)c1cc(C(C)(C)C)c2oc(C)nc2c1 |
| InChI | InChI=1S/C26H30FN3O4/c1-7-32-20-11-16-12-30(25(28)21(16)22(27)24(20)33-8-2)13-19(31)15-9-17(26(4,5)6)23-18(10-15)29-14(3)34-23/h9-11,28H,7-8,12-13H2,1-6H3/b28-25- |
| InChIKey | LRQFTKBRJHNKSU-FVDSYPCUSA-N |
| XLogP | 5.39 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|