C18H15N3O5S — CID 67138981
2-[[3-[(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)methyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 67138981) has the molecular formula C18H15N3O5S and a molecular weight of 385.40 g/mol. Its IUPAC name is 2-[[3-[(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)methyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)methyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67138981 |
| Molecular Formula | C18H15N3O5S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[[3-[(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)methyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1CN(Cc2cccc(CN3C(=O)c4ccccc4C3=O)c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C18H15N3O5S/c22-16-11-20(27(25,26)19-16)9-12-4-3-5-13(8-12)10-21-17(23)14-6-1-2-7-15(14)18(21)24/h1-8H,9-11H2,(H,19,22) |
| InChIKey | FDUWGORELVSKOM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|