C23H21N3O3 — CID 67139744
3-[(4-amino-3-phenylmethoxyphenyl)methyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 67139744) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[(4-amino-3-phenylmethoxyphenyl)methyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 3-[(4-amino-3-phenylmethoxyphenyl)methyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 67139744 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-[(4-amino-3-phenylmethoxyphenyl)methyl]-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | Nc1ccc(CC2NC(=O)c3ccccc3NC2=O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H21N3O3/c24-18-11-10-16(13-21(18)29-14-15-6-2-1-3-7-15)12-20-23(28)25-19-9-5-4-8-17(19)22(27)26-20/h1-11,13,20H,12,14,24H2,(H,25,28)(H,26,27) |
| InChIKey | YFBZUXOUHFGDIY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|