C37H42N6O6 — CID 67139839
(1-methylimidazol-2-yl) N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]carbamate (PubChem CID 67139839) has the molecular formula C37H42N6O6 and a molecular weight of 666.78 g/mol. Its IUPAC name is (1-methylimidazol-2-yl) N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]carbamate.
| Compound Name | (1-methylimidazol-2-yl) N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 67139839 |
| Molecular Formula | C37H42N6O6 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | (1-methylimidazol-2-yl) N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]carbamate |
| SMILES | COc1ccc([C@@H](CCCNC(=O)Oc2nccn2C)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H42N6O6/c1-25(26-10-6-5-7-11-26)41-20-22-42(23-21-41)30-13-8-12-28-33(30)35(45)43(34(28)44)29(27-15-16-31(47-3)32(24-27)48-4)14-9-17-39-37(46)49-36-38-18-19-40(36)2/h5-8,10-13,15-16,18-19,24-25,29H,9,14,17,20-23H2,1-4H3,(H,39,46)/t25-,29-/m1/s1 |
| InChIKey | HKGNOAMEWKKBGC-VAVYLYDRSA-N |
| XLogP | 5.23 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|