About [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane
[(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane (PubChem CID 67140174) has the molecular formula C13H24N3O4P
and a molecular weight of 317.33 g/mol. Its IUPAC name is [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane.
Molecular Properties
| Compound Name | [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane |
| PubChem CID | 67140174 |
| Molecular Formula | C13H24N3O4P |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane |
| SMILES | CCCC.Nc1ccn(C/C=C/CCP(=O)(O)O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O4P.C4H10/c10-8-4-6-12(9(13)11-8)5-2-1-3-7-17(14,15)16;1-3-4-2/h1-2,4,6H,3,5,7H2,(H2,10,11,13)(H2,14,15,16);3-4H2,1-2H3/b2-1+; |
| InChIKey | SHLUUEZUAWNLOD-TYYBGVCCSA-N |
| XLogP | 1.76 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane?
The IUPAC name of [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane (CID 67140174) is [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane.
What is the SMILES notation for [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane?
The canonical SMILES for [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane is CCCC.Nc1ccn(C/C=C/CCP(=O)(O)O)c(=O)n1.
What is the InChIKey of [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane?
The InChIKey is SHLUUEZUAWNLOD-TYYBGVCCSA-N. The full InChI is InChI=1S/C9H14N3O4P.C4H10/c10-8-4-6-12(9(13)11-8)5-2-1-3-7-17(14,15)16;1-3-4-2/h1-2,4,6H,3,5,7H2,(H2,10,11,13)(H2,14,15,16);3-4H2,1-2H3/b2-1+;.
What are the key properties of [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane?
[(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane has a molecular weight of 317.33 g/mol, XLogP of 1.76, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-5-(4-amino-2-oxopyrimidin-1-yl)pent-3-enyl]phosphonic acid;butane is sourced from PubChem (CID 67140174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).