C28H34N4O5 — CID 67140183
4-[4-(4-cyclobutylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]-4-(3,4-dimethoxyphenyl)butanamide (PubChem CID 67140183) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is 4-[4-(4-cyclobutylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]-4-(3,4-dimethoxyphenyl)butanamide.
| Compound Name | 4-[4-(4-cyclobutylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]-4-(3,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 67140183 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 4-[4-(4-cyclobutylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]-4-(3,4-dimethoxyphenyl)butanamide |
| SMILES | COc1ccc(C(CCC(N)=O)N2C(=O)c3cccc(N4CCN(C5CCC5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C28H34N4O5/c1-36-23-11-9-18(17-24(23)37-2)21(10-12-25(29)33)32-27(34)20-7-4-8-22(26(20)28(32)35)31-15-13-30(14-16-31)19-5-3-6-19/h4,7-9,11,17,19,21H,3,5-6,10,12-16H2,1-2H3,(H2,29,33) |
| InChIKey | WRKWHMRFUFXDGE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|