About N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide
N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 67140218) has the molecular formula C16H10FN5O2
and a molecular weight of 323.29 g/mol. Its IUPAC name is N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide |
| PubChem CID | 67140218 |
| Molecular Formula | C16H10FN5O2 |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(Nc1cccc(F)n1)c1cn2cc(-c3ncco3)ccc2n1 |
| InChI | InChI=1S/C16H10FN5O2/c17-12-2-1-3-13(20-12)21-15(23)11-9-22-8-10(4-5-14(22)19-11)16-18-6-7-24-16/h1-9H,(H,20,21,23) |
| InChIKey | UIFSKKUGYCYGGL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide?
The IUPAC name of N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide (CID 67140218) is N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide.
What is the SMILES notation for N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide?
The canonical SMILES for N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide is O=C(Nc1cccc(F)n1)c1cn2cc(-c3ncco3)ccc2n1.
What is the InChIKey of N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide?
The InChIKey is UIFSKKUGYCYGGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN5O2/c17-12-2-1-3-13(20-12)21-15(23)11-9-22-8-10(4-5-14(22)19-11)16-18-6-7-24-16/h1-9H,(H,20,21,23).
What are the key properties of N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide?
N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide has a molecular weight of 323.29 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-2-pyridinyl)-6-(1,3-oxazol-2-yl)imidazo[1,2-a]pyridine-2-carboxamide is sourced from PubChem (CID 67140218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).