C17H26F3NO3Si — CID 67140434
benzyl-[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropropan-2-yl]carbamic acid (PubChem CID 67140434) has the molecular formula C17H26F3NO3Si and a molecular weight of 377.48 g/mol. Its IUPAC name is benzyl-[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropropan-2-yl]carbamic acid.
| Compound Name | benzyl-[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67140434 |
| Molecular Formula | C17H26F3NO3Si |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | benzyl-[3-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropropan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC(N(Cc1ccccc1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C17H26F3NO3Si/c1-16(2,3)25(4,5)24-12-14(17(18,19)20)21(15(22)23)11-13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3,(H,22,23) |
| InChIKey | CYLKXEFOXLRCJA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|