C37H43N5O7S — CID 67140585
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[6-methyl-1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-3-methyl-1,2-oxazole-4-sulfonamide (PubChem CID 67140585) has the molecular formula C37H43N5O7S and a molecular weight of 701.85 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[6-methyl-1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-3-methyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[6-methyl-1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-3-methyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 67140585 |
| Molecular Formula | C37H43N5O7S |
| Molecular Weight | 701.85 g/mol |
| Exact Mass | 701.29 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[6-methyl-1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-3-methyl-1,2-oxazole-4-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2conc2C)N2C(=O)c3cc(C)cc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H43N5O7S/c1-24-20-29-35(31(21-24)41-18-16-40(17-19-41)26(3)27-10-7-6-8-11-27)37(44)42(36(29)43)30(28-13-14-32(47-4)33(22-28)48-5)12-9-15-38-50(45,46)34-23-49-39-25(34)2/h6-8,10-11,13-14,20-23,26,30,38H,9,12,15-19H2,1-5H3/t26-,30-/m1/s1 |
| InChIKey | LKJXBWLZFHKYJO-PDDLMNHVSA-N |
| XLogP | 5.29 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.85 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|