About (5-aminopyrazol-1-yl) carbamate
(5-aminopyrazol-1-yl) carbamate (PubChem CID 67140993) has the molecular formula C4H6N4O2
and a molecular weight of 142.12 g/mol. Its IUPAC name is (5-aminopyrazol-1-yl) carbamate.
Molecular Properties
| Compound Name | (5-aminopyrazol-1-yl) carbamate |
| PubChem CID | 67140993 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (5-aminopyrazol-1-yl) carbamate |
| SMILES | NC(=O)On1nccc1N |
| InChI | InChI=1S/C4H6N4O2/c5-3-1-2-7-8(3)10-4(6)9/h1-2H,5H2,(H2,6,9) |
| InChIKey | QEHLKDZALDFRJI-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-aminopyrazol-1-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-aminopyrazol-1-yl) carbamate?
The IUPAC name of (5-aminopyrazol-1-yl) carbamate (CID 67140993) is (5-aminopyrazol-1-yl) carbamate.
What is the SMILES notation for (5-aminopyrazol-1-yl) carbamate?
The canonical SMILES for (5-aminopyrazol-1-yl) carbamate is NC(=O)On1nccc1N.
What is the InChIKey of (5-aminopyrazol-1-yl) carbamate?
The InChIKey is QEHLKDZALDFRJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O2/c5-3-1-2-7-8(3)10-4(6)9/h1-2H,5H2,(H2,6,9).
What are the key properties of (5-aminopyrazol-1-yl) carbamate?
(5-aminopyrazol-1-yl) carbamate has a molecular weight of 142.12 g/mol, XLogP of -1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-aminopyrazol-1-yl) carbamate is sourced from PubChem (CID 67140993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).