About 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride
7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride (PubChem CID 67141451) has the molecular formula C18H18Cl2N2
and a molecular weight of 333.26 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride |
| PubChem CID | 67141451 |
| Molecular Formula | C18H18Cl2N2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride |
| SMILES | C=CCn1c(C)c(C)c2ccnc(-c3ccc(Cl)cc3)c21.Cl |
| InChI | InChI=1S/C18H17ClN2.ClH/c1-4-11-21-13(3)12(2)16-9-10-20-17(18(16)21)14-5-7-15(19)8-6-14;/h4-10H,1,11H2,2-3H3;1H |
| InChIKey | SCPHRTCOZXJJCX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride?
The IUPAC name of 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride (CID 67141451) is 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride.
What is the SMILES notation for 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride?
The canonical SMILES for 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride is C=CCn1c(C)c(C)c2ccnc(-c3ccc(Cl)cc3)c21.Cl.
What is the InChIKey of 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride?
The InChIKey is SCPHRTCOZXJJCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2.ClH/c1-4-11-21-13(3)12(2)16-9-10-20-17(18(16)21)14-5-7-15(19)8-6-14;/h4-10H,1,11H2,2-3H3;1H.
What are the key properties of 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride?
7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride has a molecular weight of 333.26 g/mol, XLogP of 5.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-chlorophenyl)-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine;hydrochloride is sourced from PubChem (CID 67141451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).