About 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine
2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine (PubChem CID 67141505) has the molecular formula C24H24N2S
and a molecular weight of 372.54 g/mol. Its IUPAC name is 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine |
| PubChem CID | 67141505 |
| Molecular Formula | C24H24N2S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine |
| SMILES | CSc1ccc(-c2nccc3c(C)c(C)n(Cc4ccc(C)cc4)c23)cc1 |
| InChI | InChI=1S/C24H24N2S/c1-16-5-7-19(8-6-16)15-26-18(3)17(2)22-13-14-25-23(24(22)26)20-9-11-21(27-4)12-10-20/h5-14H,15H2,1-4H3 |
| InChIKey | GMXGDMBAHPPXHH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine?
The IUPAC name of 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine (CID 67141505) is 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine?
The canonical SMILES for 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine is CSc1ccc(-c2nccc3c(C)c(C)n(Cc4ccc(C)cc4)c23)cc1.
What is the InChIKey of 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine?
The InChIKey is GMXGDMBAHPPXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2S/c1-16-5-7-19(8-6-16)15-26-18(3)17(2)22-13-14-25-23(24(22)26)20-9-11-21(27-4)12-10-20/h5-14H,15H2,1-4H3.
What are the key properties of 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine?
2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine has a molecular weight of 372.54 g/mol, XLogP of 6.40, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1-[(4-methylphenyl)methyl]-7-(4-methylsulfanylphenyl)pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 67141505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).