About N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine
N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine (PubChem CID 67141610) has the molecular formula C27H31N3
and a molecular weight of 397.57 g/mol. Its IUPAC name is N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine |
| PubChem CID | 67141610 |
| Molecular Formula | C27H31N3 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine |
| SMILES | Cc1c(C)n(Cc2ccc(C(C)(C)C)cc2)c2c(NCc3ccccc3)nccc12 |
| InChI | InChI=1S/C27H31N3/c1-19-20(2)30(18-22-11-13-23(14-12-22)27(3,4)5)25-24(19)15-16-28-26(25)29-17-21-9-7-6-8-10-21/h6-16H,17-18H2,1-5H3,(H,28,29) |
| InChIKey | LSYZCYUGJQHGPY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine?
The IUPAC name of N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine (CID 67141610) is N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine.
What is the SMILES notation for N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine?
The canonical SMILES for N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine is Cc1c(C)n(Cc2ccc(C(C)(C)C)cc2)c2c(NCc3ccccc3)nccc12.
What is the InChIKey of N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine?
The InChIKey is LSYZCYUGJQHGPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N3/c1-19-20(2)30(18-22-11-13-23(14-12-22)27(3,4)5)25-24(19)15-16-28-26(25)29-17-21-9-7-6-8-10-21/h6-16H,17-18H2,1-5H3,(H,28,29).
What are the key properties of N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine?
N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine has a molecular weight of 397.57 g/mol, XLogP of 6.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-[(4-tert-butylphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridin-7-amine is sourced from PubChem (CID 67141610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).