About 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride
2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride (PubChem CID 67144400) has the molecular formula C15H26ClN5
and a molecular weight of 311.86 g/mol. Its IUPAC name is 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 67144400 |
| Molecular Formula | C15H26ClN5 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride |
| SMILES | CCCCCCCCCCn1cc2c(N)ncnc2n1.Cl |
| InChI | InChI=1S/C15H25N5.ClH/c1-2-3-4-5-6-7-8-9-10-20-11-13-14(16)17-12-18-15(13)19-20;/h11-12H,2-10H2,1H3,(H2,16,17,18,19);1H |
| InChIKey | JNTGFYZBLKICFU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride (CID 67144400) is 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride is CCCCCCCCCCn1cc2c(N)ncnc2n1.Cl.
What is the InChIKey of 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is JNTGFYZBLKICFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5.ClH/c1-2-3-4-5-6-7-8-9-10-20-11-13-14(16)17-12-18-15(13)19-20;/h11-12H,2-10H2,1H3,(H2,16,17,18,19);1H.
What are the key properties of 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride?
2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 311.86 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decylpyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 67144400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).