About 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine
2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine (PubChem CID 67145630) has the molecular formula C13H18BrN5
and a molecular weight of 324.23 g/mol. Its IUPAC name is 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine |
| PubChem CID | 67145630 |
| Molecular Formula | C13H18BrN5 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine |
| SMILES | Cc1cc(N2CCNC(C)(C)C2)nn2cc(Br)nc12 |
| InChI | InChI=1S/C13H18BrN5/c1-9-6-11(17-19-7-10(14)16-12(9)19)18-5-4-15-13(2,3)8-18/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | ZWBDDRVHOLXTOD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine?
The IUPAC name of 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine (CID 67145630) is 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine?
The canonical SMILES for 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine is Cc1cc(N2CCNC(C)(C)C2)nn2cc(Br)nc12.
What is the InChIKey of 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine?
The InChIKey is ZWBDDRVHOLXTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrN5/c1-9-6-11(17-19-7-10(14)16-12(9)19)18-5-4-15-13(2,3)8-18/h6-7,15H,4-5,8H2,1-3H3.
What are the key properties of 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine?
2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine has a molecular weight of 324.23 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(3,3-dimethylpiperazin-1-yl)-8-methylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 67145630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).