About 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine
1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine (PubChem CID 67145729) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine.
Molecular Properties
| Compound Name | 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine |
| PubChem CID | 67145729 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine |
| SMILES | [H]/N=c1/c(NC)c(C)cc(C)n1O |
| InChI | InChI=1S/C8H13N3O/c1-5-4-6(2)11(12)8(9)7(5)10-3/h4,9-10,12H,1-3H3/b9-8- |
| InChIKey | LMVJFRWADKPPHG-HJWRWDBZSA-N |
| XLogP | 0.86 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine?
The IUPAC name of 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine (CID 67145729) is 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine.
What is the SMILES notation for 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine?
The canonical SMILES for 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine is [H]/N=c1/c(NC)c(C)cc(C)n1O.
What is the InChIKey of 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine?
The InChIKey is LMVJFRWADKPPHG-HJWRWDBZSA-N. The full InChI is InChI=1S/C8H13N3O/c1-5-4-6(2)11(12)8(9)7(5)10-3/h4,9-10,12H,1-3H3/b9-8-.
What are the key properties of 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine?
1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine has a molecular weight of 167.21 g/mol, XLogP of 0.86, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2-imino-N,4,6-trimethylpyridin-3-amine is sourced from PubChem (CID 67145729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).