About methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate
methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate (PubChem CID 67146155) has the molecular formula C22H24N2O2S
and a molecular weight of 380.51 g/mol. Its IUPAC name is methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate |
| PubChem CID | 67146155 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate |
| SMILES | CCCN(Cc1ccc(C(=O)OC)cc1)c1nc(-c2ccccc2)c(C)s1 |
| InChI | InChI=1S/C22H24N2O2S/c1-4-14-24(15-17-10-12-19(13-11-17)21(25)26-3)22-23-20(16(2)27-22)18-8-6-5-7-9-18/h5-13H,4,14-15H2,1-3H3 |
| InChIKey | NQEOJHHAHKBDHN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate?
The IUPAC name of methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate (CID 67146155) is methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate.
What is the SMILES notation for methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate?
The canonical SMILES for methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate is CCCN(Cc1ccc(C(=O)OC)cc1)c1nc(-c2ccccc2)c(C)s1.
What is the InChIKey of methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate?
The InChIKey is NQEOJHHAHKBDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2S/c1-4-14-24(15-17-10-12-19(13-11-17)21(25)26-3)22-23-20(16(2)27-22)18-8-6-5-7-9-18/h5-13H,4,14-15H2,1-3H3.
What are the key properties of methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate?
methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate has a molecular weight of 380.51 g/mol, XLogP of 5.32, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(5-methyl-4-phenyl-1,3-thiazol-2-yl)-propylamino]methyl]benzoate is sourced from PubChem (CID 67146155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).