About 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide
3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide (PubChem CID 67146613) has the molecular formula C18H18ClNO2
and a molecular weight of 315.80 g/mol. Its IUPAC name is 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide.
Molecular Properties
| Compound Name | 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide |
| PubChem CID | 67146613 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide |
| SMILES | NC(=O)CCc1ccc(OC2CCc3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C18H18ClNO2/c19-14-5-8-16-13(11-14)4-9-17(16)22-15-6-1-12(2-7-15)3-10-18(20)21/h1-2,5-8,11,17H,3-4,9-10H2,(H2,20,21) |
| InChIKey | QCVSEDHPIMGGSP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide?
The IUPAC name of 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide (CID 67146613) is 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide.
What is the SMILES notation for 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide?
The canonical SMILES for 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide is NC(=O)CCc1ccc(OC2CCc3cc(Cl)ccc32)cc1.
What is the InChIKey of 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide?
The InChIKey is QCVSEDHPIMGGSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNO2/c19-14-5-8-16-13(11-14)4-9-17(16)22-15-6-1-12(2-7-15)3-10-18(20)21/h1-2,5-8,11,17H,3-4,9-10H2,(H2,20,21).
What are the key properties of 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide?
3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide has a molecular weight of 315.80 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(5-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]propanamide is sourced from PubChem (CID 67146613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).