About 2-amino-3H-1,3-benzoxazole-2-sulfonamide
2-amino-3H-1,3-benzoxazole-2-sulfonamide (PubChem CID 67147247) has the molecular formula C7H9N3O3S
and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-amino-3H-1,3-benzoxazole-2-sulfonamide.
Molecular Properties
| Compound Name | 2-amino-3H-1,3-benzoxazole-2-sulfonamide |
| PubChem CID | 67147247 |
| Molecular Formula | C7H9N3O3S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 2-amino-3H-1,3-benzoxazole-2-sulfonamide |
| SMILES | NC1(S(N)(=O)=O)Nc2ccccc2O1 |
| InChI | InChI=1S/C7H9N3O3S/c8-7(14(9,11)12)10-5-3-1-2-4-6(5)13-7/h1-4,10H,8H2,(H2,9,11,12) |
| InChIKey | SDCCPSGJFZFNPB-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-3H-1,3-benzoxazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3H-1,3-benzoxazole-2-sulfonamide?
The IUPAC name of 2-amino-3H-1,3-benzoxazole-2-sulfonamide (CID 67147247) is 2-amino-3H-1,3-benzoxazole-2-sulfonamide.
What is the SMILES notation for 2-amino-3H-1,3-benzoxazole-2-sulfonamide?
The canonical SMILES for 2-amino-3H-1,3-benzoxazole-2-sulfonamide is NC1(S(N)(=O)=O)Nc2ccccc2O1.
What is the InChIKey of 2-amino-3H-1,3-benzoxazole-2-sulfonamide?
The InChIKey is SDCCPSGJFZFNPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O3S/c8-7(14(9,11)12)10-5-3-1-2-4-6(5)13-7/h1-4,10H,8H2,(H2,9,11,12).
What are the key properties of 2-amino-3H-1,3-benzoxazole-2-sulfonamide?
2-amino-3H-1,3-benzoxazole-2-sulfonamide has a molecular weight of 215.23 g/mol, XLogP of -0.65, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3H-1,3-benzoxazole-2-sulfonamide is sourced from PubChem (CID 67147247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).