About N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline
N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline (PubChem CID 67147340) has the molecular formula C21H28ClN3O4S
and a molecular weight of 453.99 g/mol. Its IUPAC name is N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline.
Molecular Properties
| Compound Name | N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline |
| PubChem CID | 67147340 |
| Molecular Formula | C21H28ClN3O4S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline |
| SMILES | COc1cc(Cl)cc([C@H](C)Nc2cc(N3CCNCC3)ccc2S(C)(=O)=O)c1OC |
| InChI | InChI=1S/C21H28ClN3O4S/c1-14(17-11-15(22)12-19(28-2)21(17)29-3)24-18-13-16(25-9-7-23-8-10-25)5-6-20(18)30(4,26)27/h5-6,11-14,23-24H,7-10H2,1-4H3/t14-/m0/s1 |
| InChIKey | BSLXKMCHXRCBIH-AWEZNQCLSA-N |
| XLogP | 3.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline?
The IUPAC name of N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline (CID 67147340) is N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline.
What is the SMILES notation for N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline?
The canonical SMILES for N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline is COc1cc(Cl)cc([C@H](C)Nc2cc(N3CCNCC3)ccc2S(C)(=O)=O)c1OC.
What is the InChIKey of N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline?
The InChIKey is BSLXKMCHXRCBIH-AWEZNQCLSA-N. The full InChI is InChI=1S/C21H28ClN3O4S/c1-14(17-11-15(22)12-19(28-2)21(17)29-3)24-18-13-16(25-9-7-23-8-10-25)5-6-20(18)30(4,26)27/h5-6,11-14,23-24H,7-10H2,1-4H3/t14-/m0/s1.
What are the key properties of N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline?
N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline has a molecular weight of 453.99 g/mol, XLogP of 3.34, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(5-chloro-2,3-dimethoxyphenyl)ethyl]-2-methylsulfonyl-5-piperazin-1-ylaniline is sourced from PubChem (CID 67147340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).