About N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine
N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine (PubChem CID 67147353) has the molecular formula C21H27ClN6O2
and a molecular weight of 430.94 g/mol. Its IUPAC name is N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine |
| PubChem CID | 67147353 |
| Molecular Formula | C21H27ClN6O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine |
| SMILES | CCOc1cc(CN2CCC(Nc3ncnc4nc[nH]c34)CC2)cc(OCC)c1Cl |
| InChI | InChI=1S/C21H27ClN6O2/c1-3-29-16-9-14(10-17(18(16)22)30-4-2)11-28-7-5-15(6-8-28)27-21-19-20(24-12-23-19)25-13-26-21/h9-10,12-13,15H,3-8,11H2,1-2H3,(H2,23,24,25,26,27) |
| InChIKey | ZZIXBQKLJOZBJQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine?
The IUPAC name of N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine (CID 67147353) is N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine.
What is the SMILES notation for N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine?
The canonical SMILES for N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine is CCOc1cc(CN2CCC(Nc3ncnc4nc[nH]c34)CC2)cc(OCC)c1Cl.
What is the InChIKey of N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine?
The InChIKey is ZZIXBQKLJOZBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27ClN6O2/c1-3-29-16-9-14(10-17(18(16)22)30-4-2)11-28-7-5-15(6-8-28)27-21-19-20(24-12-23-19)25-13-26-21/h9-10,12-13,15H,3-8,11H2,1-2H3,(H2,23,24,25,26,27).
What are the key properties of N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine?
N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine has a molecular weight of 430.94 g/mol, XLogP of 3.88, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(4-chloro-3,5-diethoxyphenyl)methyl]piperidin-4-yl]-7H-purin-6-amine is sourced from PubChem (CID 67147353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).