C6H6N2O2 — CID 67147391
2,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione (PubChem CID 67147391) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 2,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione.
| Compound Name | 2,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 67147391 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-4,6-dione |
| SMILES | O=C1NC(=O)C2CNC=C12 |
| InChI | InChI=1S/C6H6N2O2/c9-5-3-1-7-2-4(3)6(10)8-5/h1,4,7H,2H2,(H,8,9,10) |
| InChIKey | PYSMFVQYAONVHY-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|