C35H42F3N5O8S — CID 67147472
2-[3-[2-[5,6-dimethoxy-3-[1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]indol-1-yl]ethylamino]propyl-(2-hydroxyethyl)amino]ethanol;2,2,2-trifluoroacetic acid (PubChem CID 67147472) has the molecular formula C35H42F3N5O8S and a molecular weight of 749.81 g/mol. Its IUPAC name is 2-[3-[2-[5,6-dimethoxy-3-[1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]indol-1-yl]ethylamino]propyl-(2-hydroxyethyl)amino]ethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-[2-[5,6-dimethoxy-3-[1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]indol-1-yl]ethylamino]propyl-(2-hydroxyethyl)amino]ethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67147472 |
| Molecular Formula | C35H42F3N5O8S |
| Molecular Weight | 749.81 g/mol |
| Exact Mass | 749.27 |
| IUPAC Name | 2-[3-[2-[5,6-dimethoxy-3-[1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]indol-1-yl]ethylamino]propyl-(2-hydroxyethyl)amino]ethanol;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc2c(-c3cc4cccnc4n3S(=O)(=O)c3ccc(C)cc3)cn(CCNCCCN(CCO)CCO)c2cc1OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H41N5O6S.C2HF3O2/c1-24-7-9-26(10-8-24)45(41,42)38-30(20-25-6-4-12-35-33(25)38)28-23-37(29-22-32(44-3)31(43-2)21-27(28)29)15-13-34-11-5-14-36(16-18-39)17-19-40;3-2(4,5)1(6)7/h4,6-10,12,20-23,34,39-40H,5,11,13-19H2,1-3H3;(H,6,7) |
| InChIKey | YWWLUFJARPVAKB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 168.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.81 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|