C28H28ClN3O5S — CID 67147647
2-[6-[2-(2-chloroethoxy)ethoxy]-5-methoxy-1-methylindol-3-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 67147647) has the molecular formula C28H28ClN3O5S and a molecular weight of 554.07 g/mol. Its IUPAC name is 2-[6-[2-(2-chloroethoxy)ethoxy]-5-methoxy-1-methylindol-3-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
| Compound Name | 2-[6-[2-(2-chloroethoxy)ethoxy]-5-methoxy-1-methylindol-3-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 67147647 |
| Molecular Formula | C28H28ClN3O5S |
| Molecular Weight | 554.07 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 2-[6-[2-(2-chloroethoxy)ethoxy]-5-methoxy-1-methylindol-3-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | COc1cc2c(-c3cc4cccnc4n3S(=O)(=O)c3ccc(C)cc3)cn(C)c2cc1OCCOCCCl |
| InChI | InChI=1S/C28H28ClN3O5S/c1-19-6-8-21(9-7-19)38(33,34)32-25(15-20-5-4-11-30-28(20)32)23-18-31(2)24-17-27(26(35-3)16-22(23)24)37-14-13-36-12-10-29/h4-9,11,15-18H,10,12-14H2,1-3H3 |
| InChIKey | IBJSDZQADQQJDC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 84.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.07 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|