About 2-pyridin-3-yl-8,9-dihydro-7H-purine
2-pyridin-3-yl-8,9-dihydro-7H-purine (PubChem CID 67148463) has the molecular formula C10H9N5
and a molecular weight of 199.22 g/mol. Its IUPAC name is 2-pyridin-3-yl-8,9-dihydro-7H-purine.
Molecular Properties
| Compound Name | 2-pyridin-3-yl-8,9-dihydro-7H-purine |
| PubChem CID | 67148463 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 2-pyridin-3-yl-8,9-dihydro-7H-purine |
| SMILES | c1cncc(-c2ncc3c(n2)NCN3)c1 |
| InChI | InChI=1S/C10H9N5/c1-2-7(4-11-3-1)9-12-5-8-10(15-9)14-6-13-8/h1-5,13H,6H2,(H,12,14,15) |
| InChIKey | MNVJPHSTBQMBJQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyridin-3-yl-8,9-dihydro-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-yl-8,9-dihydro-7H-purine?
The IUPAC name of 2-pyridin-3-yl-8,9-dihydro-7H-purine (CID 67148463) is 2-pyridin-3-yl-8,9-dihydro-7H-purine.
What is the SMILES notation for 2-pyridin-3-yl-8,9-dihydro-7H-purine?
The canonical SMILES for 2-pyridin-3-yl-8,9-dihydro-7H-purine is c1cncc(-c2ncc3c(n2)NCN3)c1.
What is the InChIKey of 2-pyridin-3-yl-8,9-dihydro-7H-purine?
The InChIKey is MNVJPHSTBQMBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5/c1-2-7(4-11-3-1)9-12-5-8-10(15-9)14-6-13-8/h1-5,13H,6H2,(H,12,14,15).
What are the key properties of 2-pyridin-3-yl-8,9-dihydro-7H-purine?
2-pyridin-3-yl-8,9-dihydro-7H-purine has a molecular weight of 199.22 g/mol, XLogP of 1.33, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yl-8,9-dihydro-7H-purine is sourced from PubChem (CID 67148463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).