C19H38O5Si — CID 67148507
(2R)-2-[(4R,5R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid (PubChem CID 67148507) has the molecular formula C19H38O5Si and a molecular weight of 374.59 g/mol. Its IUPAC name is (2R)-2-[(4R,5R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid.
| Compound Name | (2R)-2-[(4R,5R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 67148507 |
| Molecular Formula | C19H38O5Si |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (2R)-2-[(4R,5R,6R)-6-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]propanoic acid |
| SMILES | C[C@H]1[C@H]([C@@H](C)C(=O)O)OC(C)(C)O[C@@H]1CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O5Si/c1-13-15(11-10-12-22-25(8,9)18(3,4)5)23-19(6,7)24-16(13)14(2)17(20)21/h13-16H,10-12H2,1-9H3,(H,20,21)/t13-,14-,15-,16-/m1/s1 |
| InChIKey | LGDCTWNIPNWRKP-KLHDSHLOSA-N |
| XLogP | 4.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|