C23H37NO5Si — CID 67148562
(4S)-4-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one (PubChem CID 67148562) has the molecular formula C23H37NO5Si and a molecular weight of 435.64 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67148562 |
| Molecular Formula | C23H37NO5Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | (4S)-4-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,4-dimethylpentanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(CO)C(O[Si](C)(C)C(C)(C)C)C(C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H37NO5Si/c1-16(14-25)20(29-30(6,7)23(3,4)5)17(2)21(26)24-19(15-28-22(24)27)13-18-11-9-8-10-12-18/h8-12,16-17,19-20,25H,13-15H2,1-7H3/t16?,17?,19-,20?/m0/s1 |
| InChIKey | RJGTULNYWPJNFX-JLYZFGFVSA-N |
| XLogP | 4.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|