C13H16N2O4 — CID 67149117
prop-2-enyl 3-hydroxy-4-oxo-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepine-2-carboxylate (PubChem CID 67149117) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is prop-2-enyl 3-hydroxy-4-oxo-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepine-2-carboxylate.
| Compound Name | prop-2-enyl 3-hydroxy-4-oxo-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepine-2-carboxylate |
|---|---|
| PubChem CID | 67149117 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | prop-2-enyl 3-hydroxy-4-oxo-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepine-2-carboxylate |
| SMILES | C=CCOC(=O)c1nc2n(c(=O)c1O)CCCCC2 |
| InChI | InChI=1S/C13H16N2O4/c1-2-8-19-13(18)10-11(16)12(17)15-7-5-3-4-6-9(15)14-10/h2,16H,1,3-8H2 |
| InChIKey | YOIKXFHKFASHMW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|