C12H14N2O4 — CID 67149124
prop-2-enyl 3-hydroxy-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate (PubChem CID 67149124) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is prop-2-enyl 3-hydroxy-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | prop-2-enyl 3-hydroxy-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 67149124 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | prop-2-enyl 3-hydroxy-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-2-carboxylate |
| SMILES | C=CCOC(=O)c1nc2n(c(=O)c1O)CCCC2 |
| InChI | InChI=1S/C12H14N2O4/c1-2-7-18-12(17)9-10(15)11(16)14-6-4-3-5-8(14)13-9/h2,15H,1,3-7H2 |
| InChIKey | IYHPTYQMHGDACO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|