C17H21F3N4O — CID 67149602
(2R)-5-(1-methyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxan-3-amine (PubChem CID 67149602) has the molecular formula C17H21F3N4O and a molecular weight of 354.38 g/mol. Its IUPAC name is (2R)-5-(1-methyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxan-3-amine.
| Compound Name | (2R)-5-(1-methyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxan-3-amine |
|---|---|
| PubChem CID | 67149602 |
| Molecular Formula | C17H21F3N4O |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2R)-5-(1-methyl-4,6-dihydropyrrolo[3,4-d]pyrazol-5-yl)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxan-3-amine |
| SMILES | Cn1ncc2c1CN(C1CO[C@H](C3CC(F)=C(F)C=C3F)C(N)C1)C2 |
| InChI | InChI=1S/C17H21F3N4O/c1-23-16-7-24(6-9(16)5-22-23)10-2-15(21)17(25-8-10)11-3-13(19)14(20)4-12(11)18/h4-5,10-11,15,17H,2-3,6-8,21H2,1H3/t10?,11?,15?,17-/m1/s1 |
| InChIKey | GSBTVCGPHDOYHV-SLRIFWEESA-N |
| XLogP | 2.24 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |