C23H30ClN3O2 — CID 67150457
[(3aR,4R,9bR)-4-(2-methylfuran-3-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-[(1S,2R)-2-aminocyclohexyl]methanone;hydrochloride (PubChem CID 67150457) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is [(3aR,4R,9bR)-4-(2-methylfuran-3-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-[(1S,2R)-2-aminocyclohexyl]methanone;hydrochloride.
| Compound Name | [(3aR,4R,9bR)-4-(2-methylfuran-3-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-[(1S,2R)-2-aminocyclohexyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 67150457 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [(3aR,4R,9bR)-4-(2-methylfuran-3-yl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-[(1S,2R)-2-aminocyclohexyl]methanone;hydrochloride |
| SMILES | Cc1occc1[C@@H]1Nc2ccccc2[C@H]2[C@@H]1CCN2C(=O)[C@H]1CCCC[C@H]1N.Cl |
| InChI | InChI=1S/C23H29N3O2.ClH/c1-14-15(11-13-28-14)21-18-10-12-26(23(27)16-6-2-4-8-19(16)24)22(18)17-7-3-5-9-20(17)25-21;/h3,5,7,9,11,13,16,18-19,21-22,25H,2,4,6,8,10,12,24H2,1H3;1H/t16-,18+,19+,21-,22-;/m0./s1 |
| InChIKey | ZHRQJQUFIWNNMO-DQPJJEPZSA-N |
| XLogP | 4.58 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |