C31H33ClN4O2 — CID 67150563
1-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(2-chlorophenyl)urea (PubChem CID 67150563) has the molecular formula C31H33ClN4O2 and a molecular weight of 529.08 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 67150563 |
| Molecular Formula | C31H33ClN4O2 |
| Molecular Weight | 529.08 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 1-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(2-chlorophenyl)urea |
| SMILES | O=C(Nc1ccccc1Cl)N[C@@H]1CCCC[C@@H]1C(=O)N1CC[C@H]2[C@H](c3ccccc3)Nc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C31H33ClN4O2/c32-24-14-6-9-17-27(24)35-31(38)34-26-16-8-5-13-22(26)30(37)36-19-18-23-28(20-10-2-1-3-11-20)33-25-15-7-4-12-21(25)29(23)36/h1-4,6-7,9-12,14-15,17,22-23,26,28-29,33H,5,8,13,16,18-19H2,(H2,34,35,38)/t22-,23-,26+,28-,29-/m0/s1 |
| InChIKey | VFOFBOSCMSNBFR-WLPPXWGBSA-N |
| XLogP | 6.78 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.08 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |