C30H39N3O3 — CID 67150632
N-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-6-hydroxyhexanamide (PubChem CID 67150632) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-6-hydroxyhexanamide.
| Compound Name | N-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-6-hydroxyhexanamide |
|---|---|
| PubChem CID | 67150632 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | N-[(1R,2S)-2-[(3aS,4R,9bR)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-6-hydroxyhexanamide |
| SMILES | O=C(CCCCCO)N[C@@H]1CCCC[C@@H]1C(=O)N1CC[C@H]2[C@H](c3ccccc3)Nc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C30H39N3O3/c34-20-10-2-5-17-27(35)31-26-16-9-7-14-23(26)30(36)33-19-18-24-28(21-11-3-1-4-12-21)32-25-15-8-6-13-22(25)29(24)33/h1,3-4,6,8,11-13,15,23-24,26,28-29,32,34H,2,5,7,9-10,14,16-20H2,(H,31,35)/t23-,24-,26+,28-,29-/m0/s1 |
| InChIKey | JISAEMNTDPLVER-YVOYMEIZSA-N |
| XLogP | 4.97 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|