C31H33N5O2S — CID 67150781
N-[(1R,2S)-2-[(3aS,4R,9bR)-4-thiophen-3-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-2-methyl-3H-benzimidazole-5-carboxamide (PubChem CID 67150781) has the molecular formula C31H33N5O2S and a molecular weight of 539.71 g/mol. Its IUPAC name is N-[(1R,2S)-2-[(3aS,4R,9bR)-4-thiophen-3-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-2-methyl-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(1R,2S)-2-[(3aS,4R,9bR)-4-thiophen-3-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-2-methyl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 67150781 |
| Molecular Formula | C31H33N5O2S |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | N-[(1R,2S)-2-[(3aS,4R,9bR)-4-thiophen-3-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-2-methyl-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)N[C@@H]3CCCC[C@@H]3C(=O)N3CC[C@H]4[C@H](c5ccsc5)Nc5ccccc5[C@@H]43)cc2[nH]1 |
| InChI | InChI=1S/C31H33N5O2S/c1-18-32-26-11-10-19(16-27(26)33-18)30(37)35-25-9-5-3-7-22(25)31(38)36-14-12-23-28(20-13-15-39-17-20)34-24-8-4-2-6-21(24)29(23)36/h2,4,6,8,10-11,13,15-17,22-23,25,28-29,34H,3,5,7,9,12,14H2,1H3,(H,32,33)(H,35,37)/t22-,23-,25+,28-,29-/m0/s1 |
| InChIKey | UBZRNSCRFNMTGJ-YDULCBHVSA-N |
| XLogP | 5.98 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |