About [4-(cyanomethyl)phenyl] cyanate
[4-(cyanomethyl)phenyl] cyanate (PubChem CID 67151191) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is [4-(cyanomethyl)phenyl] cyanate.
Molecular Properties
| Compound Name | [4-(cyanomethyl)phenyl] cyanate |
| PubChem CID | 67151191 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | [4-(cyanomethyl)phenyl] cyanate |
| SMILES | N#CCc1ccc(OC#N)cc1 |
| InChI | InChI=1S/C9H6N2O/c10-6-5-8-1-3-9(4-2-8)12-7-11/h1-4H,5H2 |
| InChIKey | UHEOZZVFWFYOPS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-(cyanomethyl)phenyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(cyanomethyl)phenyl] cyanate?
The IUPAC name of [4-(cyanomethyl)phenyl] cyanate (CID 67151191) is [4-(cyanomethyl)phenyl] cyanate.
What is the SMILES notation for [4-(cyanomethyl)phenyl] cyanate?
The canonical SMILES for [4-(cyanomethyl)phenyl] cyanate is N#CCc1ccc(OC#N)cc1.
What is the InChIKey of [4-(cyanomethyl)phenyl] cyanate?
The InChIKey is UHEOZZVFWFYOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c10-6-5-8-1-3-9(4-2-8)12-7-11/h1-4H,5H2.
What are the key properties of [4-(cyanomethyl)phenyl] cyanate?
[4-(cyanomethyl)phenyl] cyanate has a molecular weight of 158.16 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(cyanomethyl)phenyl] cyanate is sourced from PubChem (CID 67151191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).