About methylsulfanylmethane;pyrrolidine-2,5-dione
methylsulfanylmethane;pyrrolidine-2,5-dione (PubChem CID 67151345) has the molecular formula C6H11NO2S
and a molecular weight of 161.23 g/mol. Its IUPAC name is methylsulfanylmethane;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | methylsulfanylmethane;pyrrolidine-2,5-dione |
| PubChem CID | 67151345 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | methylsulfanylmethane;pyrrolidine-2,5-dione |
| SMILES | CSC.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C2H6S/c6-3-1-2-4(7)5-3;1-3-2/h1-2H2,(H,5,6,7);1-2H3 |
| InChIKey | ZENPATJXKOUUKY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanylmethane;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanylmethane;pyrrolidine-2,5-dione?
The IUPAC name of methylsulfanylmethane;pyrrolidine-2,5-dione (CID 67151345) is methylsulfanylmethane;pyrrolidine-2,5-dione.
What is the SMILES notation for methylsulfanylmethane;pyrrolidine-2,5-dione?
The canonical SMILES for methylsulfanylmethane;pyrrolidine-2,5-dione is CSC.O=C1CCC(=O)N1.
What is the InChIKey of methylsulfanylmethane;pyrrolidine-2,5-dione?
The InChIKey is ZENPATJXKOUUKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C2H6S/c6-3-1-2-4(7)5-3;1-3-2/h1-2H2,(H,5,6,7);1-2H3.
What are the key properties of methylsulfanylmethane;pyrrolidine-2,5-dione?
methylsulfanylmethane;pyrrolidine-2,5-dione has a molecular weight of 161.23 g/mol, XLogP of 0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanylmethane;pyrrolidine-2,5-dione is sourced from PubChem (CID 67151345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).