About 5-methyl-2-trityl-1,2-benzoxazol-3-one
5-methyl-2-trityl-1,2-benzoxazol-3-one (PubChem CID 67151446) has the molecular formula C27H21NO2
and a molecular weight of 391.47 g/mol. Its IUPAC name is 5-methyl-2-trityl-1,2-benzoxazol-3-one.
Molecular Properties
| Compound Name | 5-methyl-2-trityl-1,2-benzoxazol-3-one |
| PubChem CID | 67151446 |
| Molecular Formula | C27H21NO2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 5-methyl-2-trityl-1,2-benzoxazol-3-one |
| SMILES | Cc1ccc2on(C(c3ccccc3)(c3ccccc3)c3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C27H21NO2/c1-20-17-18-25-24(19-20)26(29)28(30-25)27(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-19H,1H3 |
| InChIKey | QGTLANCXCAIGCD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-trityl-1,2-benzoxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-trityl-1,2-benzoxazol-3-one?
The IUPAC name of 5-methyl-2-trityl-1,2-benzoxazol-3-one (CID 67151446) is 5-methyl-2-trityl-1,2-benzoxazol-3-one.
What is the SMILES notation for 5-methyl-2-trityl-1,2-benzoxazol-3-one?
The canonical SMILES for 5-methyl-2-trityl-1,2-benzoxazol-3-one is Cc1ccc2on(C(c3ccccc3)(c3ccccc3)c3ccccc3)c(=O)c2c1.
What is the InChIKey of 5-methyl-2-trityl-1,2-benzoxazol-3-one?
The InChIKey is QGTLANCXCAIGCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21NO2/c1-20-17-18-25-24(19-20)26(29)28(30-25)27(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-19H,1H3.
What are the key properties of 5-methyl-2-trityl-1,2-benzoxazol-3-one?
5-methyl-2-trityl-1,2-benzoxazol-3-one has a molecular weight of 391.47 g/mol, XLogP of 5.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-trityl-1,2-benzoxazol-3-one is sourced from PubChem (CID 67151446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).