About 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole
4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole (PubChem CID 67151934) has the molecular formula C26H24F2N2O3
and a molecular weight of 450.49 g/mol. Its IUPAC name is 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole.
Molecular Properties
| Compound Name | 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole |
| PubChem CID | 67151934 |
| Molecular Formula | C26H24F2N2O3 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole |
| SMILES | COc1cc(F)c(F)cc1-c1ccc(OCc2cccc3c2cnn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C26H24F2N2O3/c1-31-25-14-23(28)22(27)13-20(25)17-8-10-19(11-9-17)33-16-18-5-4-6-24-21(18)15-29-30(24)26-7-2-3-12-32-26/h4-6,8-11,13-15,26H,2-3,7,12,16H2,1H3 |
| InChIKey | RQUBDMPXVZLOIS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole?
The IUPAC name of 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole (CID 67151934) is 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole.
What is the SMILES notation for 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole?
The canonical SMILES for 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole is COc1cc(F)c(F)cc1-c1ccc(OCc2cccc3c2cnn3C2CCCCO2)cc1.
What is the InChIKey of 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole?
The InChIKey is RQUBDMPXVZLOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24F2N2O3/c1-31-25-14-23(28)22(27)13-20(25)17-8-10-19(11-9-17)33-16-18-5-4-6-24-21(18)15-29-30(24)26-7-2-3-12-32-26/h4-6,8-11,13-15,26H,2-3,7,12,16H2,1H3.
What are the key properties of 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole?
4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole has a molecular weight of 450.49 g/mol, XLogP of 6.27, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4,5-difluoro-2-methoxyphenyl)phenoxy]methyl]-1-(oxan-2-yl)indazole is sourced from PubChem (CID 67151934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).