C20H17ClN4 — CID 67151943
5-chloro-1,2,3,4,21,23-hexahydroporphyrin (PubChem CID 67151943) has the molecular formula C20H17ClN4 and a molecular weight of 348.84 g/mol. Its IUPAC name is 5-chloro-1,2,3,4,21,23-hexahydroporphyrin.
| Compound Name | 5-chloro-1,2,3,4,21,23-hexahydroporphyrin |
|---|---|
| PubChem CID | 67151943 |
| Molecular Formula | C20H17ClN4 |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 5-chloro-1,2,3,4,21,23-hexahydroporphyrin |
| SMILES | ClC1=C2C=CC(=N2)C=c2ccc([nH]2)=CC2=NC(=CC3CCC1N3)C=C2 |
| InChI | InChI=1S/C20H17ClN4/c21-20-18-7-5-16(24-18)10-14-3-1-12(22-14)9-13-2-4-15(23-13)11-17-6-8-19(20)25-17/h1-5,7,9-11,17,19,22,25H,6,8H2 |
| InChIKey | OSRYTOXREFYUKU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |