About 5-bromoporphyrin
5-bromoporphyrin (PubChem CID 67151953) has the molecular formula C20H11BrN4
and a molecular weight of 387.24 g/mol. Its IUPAC name is 5-bromoporphyrin.
Molecular Properties
| Compound Name | 5-bromoporphyrin |
| PubChem CID | 67151953 |
| Molecular Formula | C20H11BrN4 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 5-bromoporphyrin |
| SMILES | Br/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C=C2/C=CC(=N2)/C=C2/C=CC1=N2 |
| InChI | InChI=1S/C20H11BrN4/c21-20-18-7-5-16(24-18)10-14-3-1-12(22-14)9-13-2-4-15(23-13)11-17-6-8-19(20)25-17/h1-11H/b12-9-,13-9-,14-10-,15-11-,16-10-,17-11-,20-18+,20-19+ |
| InChIKey | ZFTGQOXTSLAYBE-DRCNEUIKSA-N |
| XLogP | 4.30 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromoporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromoporphyrin?
The IUPAC name of 5-bromoporphyrin (CID 67151953) is 5-bromoporphyrin.
What is the SMILES notation for 5-bromoporphyrin?
The canonical SMILES for 5-bromoporphyrin is Br/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C=C2/C=CC(=N2)/C=C2/C=CC1=N2.
What is the InChIKey of 5-bromoporphyrin?
The InChIKey is ZFTGQOXTSLAYBE-DRCNEUIKSA-N. The full InChI is InChI=1S/C20H11BrN4/c21-20-18-7-5-16(24-18)10-14-3-1-12(22-14)9-13-2-4-15(23-13)11-17-6-8-19(20)25-17/h1-11H/b12-9-,13-9-,14-10-,15-11-,16-10-,17-11-,20-18+,20-19+.
What are the key properties of 5-bromoporphyrin?
5-bromoporphyrin has a molecular weight of 387.24 g/mol, XLogP of 4.30, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromoporphyrin is sourced from PubChem (CID 67151953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).